CAS 886216-67-7

2-Pentanamine, 1-fluoro-, hydrochloride (1:1), (2S)-

Description:

2-Pentanamine, 1-fluoro-, hydrochloride (1:1), (2S)- is a chemical compound characterized by its amine functional group and the presence of a fluorine atom. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. The compound features a five-carbon chain with an amine group located at the second carbon, indicating its classification as a primary amine. The (2S)- designation denotes its specific stereochemistry, which is crucial for its biological activity and interactions. This compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its reactivity and solubility. Additionally, the presence of the fluorine atom can impart unique electronic properties, potentially affecting its pharmacological profile. Due to its structural characteristics, 2-pentanamine, 1-fluoro-, hydrochloride may be of interest in medicinal chemistry and drug development, particularly in the synthesis of biologically active molecules.

Formula: C₅H₁₂FN·ClH

InChI: InChI=1S/C5H12FN.ClH/c1-2-3-5(7)4-6;/h5H,2-4,7H2,1H3;1H/t5-;/m0./s1

InChI key: InChIKey=YIAJCBIUAABDEC-JEDNCBNOSA-N

SMILES: [C@H](CCC)(CF)N.Cl

Synonyms:

• 2-Pentanamine, 1-fluoro-, hydrochloride, (2S)-
• 2-Pentanamine, 1-fluoro-, hydrochloride (1:1), (2S)-