CAS 88624-85-5
:6,8-Dibromo-2-ethyl-4(3H)-quinazolinone
Description:
6,8-Dibromo-2-ethyl-4(3H)-quinazolinone is a synthetic organic compound characterized by its quinazolinone structure, which features a fused bicyclic system containing both a benzene and a pyrimidine ring. This compound is notable for the presence of two bromine atoms at the 6 and 8 positions, which can significantly influence its reactivity and biological activity. The ethyl group at the 2-position contributes to its lipophilicity, potentially enhancing its ability to penetrate biological membranes. Typically, compounds like this may exhibit various pharmacological properties, including antimicrobial or anticancer activities, although specific biological data would depend on empirical studies. The presence of halogens, such as bromine, often enhances the compound's stability and can affect its interaction with biological targets. Additionally, 6,8-Dibromo-2-ethyl-4(3H)-quinazolinone may be of interest in medicinal chemistry and material science due to its unique structural features and potential applications in drug development or as a chemical probe.
Formula:C10H8Br2N2O
InChI:InChI=1S/C10H8Br2N2O/c1-2-8-13-9-6(10(15)14-8)3-5(11)4-7(9)12/h3-4H,2H2,1H3,(H,13,14,15)
InChI key:InChIKey=VWSVQXAIUHXKBR-UHFFFAOYSA-N
SMILES:BrC1=C2C(C(=O)N=C(CC)N2)=CC(Br)=C1
Synonyms:- 6,8-Dibromo-2-ethyl-4(3H)-quinazolinone
- 4(1H)-Quinazolinone, 6,8-dibromo-2-ethyl-
- 4(3H)-Quinazolinone, 6,8-dibromo-2-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
