
CAS 88629-04-3
:2-Bromo-N-(2-cyanophenyl)butanamide
Description:
2-Bromo-N-(2-cyanophenyl)butanamide is an organic compound characterized by its amide functional group, which is derived from butanoic acid and features a bromine atom and a cyanophenyl substituent. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The cyanophenyl group, containing a cyano (-CN) functional group attached to a phenyl ring, contributes to the compound's potential for various chemical interactions, including nucleophilic substitutions and electrophilic additions. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic character, while the polar amide and cyano groups may enhance solubility in polar solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the amide and cyano functionalities, which are often found in biologically active compounds. Additionally, the compound's unique characteristics may allow for specific interactions in biological systems, making it a candidate for further research in drug design and synthesis.
Formula:C11H11BrN2O
InChI:InChI=1S/C11H11BrN2O/c1-2-9(12)11(15)14-10-6-4-3-5-8(10)7-13/h3-6,9H,2H2,1H3,(H,14,15)
InChI key:InChIKey=MQEAEJGQMWSJFQ-UHFFFAOYSA-N
SMILES:N(C(C(CC)Br)=O)C1=C(C#N)C=CC=C1
Synonyms:- Butanamide, 2-bromo-N-(2-cyanophenyl)-
- 2-Bromo-N-(2-cyanophenyl)butanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
