
CAS 88634-80-4
:2-ethyl-4-methyl-1H-imidazole-5-carbaldehyde
Description:
2-Ethyl-4-methyl-1H-imidazole-5-carbaldehyde is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an aldehyde functional group (-CHO) at the 5-position of the imidazole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of ethyl and methyl substituents at the 2 and 4 positions, respectively, enhances its steric and electronic properties, which can influence its behavior in chemical reactions. Typically, compounds like this may exhibit biological activity, making them of interest in pharmaceutical research. Additionally, the compound's structure suggests it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions, due to the electrophilic nature of the aldehyde group. Its unique combination of functional groups and structural features makes it a valuable compound for further study in both synthetic and medicinal chemistry contexts.
Formula:C7H10N2O
InChI:InChI=1/C7H10N2O/c1-3-7-8-5(2)6(4-10)9-7/h4H,3H2,1-2H3,(H,8,9)
SMILES:CCc1[nH]c(C)c(C=O)n1
Synonyms:- 2-ethyl-5-methyl-1H-imidazole-4-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Imidazole-5-carboxaldehyde,2-ethyl-4-methyl-
CAS:Formula:C7H10N2OPurity:97%Color and Shape:SolidMolecular weight:138.16712-Ethyl-4-methyl-1H-imidazole-5-carboxaldehyde
CAS:2-Ethyl-4-methyl-1H-imidazole-5-carboxaldehydeFormula:C7H10N2OPurity:≥95%Color and Shape:Off-White PowderMolecular weight:138.17g/mol2-Ethyl-4-methyl-1H-imidazole-5-carbaldehyde
CAS:Formula:C7H10N2OPurity:97%Color and Shape:SolidMolecular weight:138.171H-Imidazole-4-carboxaldehyde, 2-ethyl-5-methyl-
CAS:1H-Imidazole-4-carboxaldehyde, 2-ethyl-5-methyl-, is a mononuclear ligand that can be immobilized on magnetic plates. It has been used in catalytic studies of transition metal complexes and unsymmetrical architectures. The ligand has been shown to have a strong magnetic moment with two methyl groups on the nitrogen atoms that are capable of coordinating to metal ions. This ligand has been studied using several crystallographic methodologies, including X-ray diffraction, electron diffraction, and NMR spectroscopy. The polymorphs of this compound include trigonal bipyramidal (P3) and cubic (Fd3m).Formula:C7H10N2OPurity:Min. 95%Molecular weight:138.17 g/mol



