CymitQuimica logo

CAS 886360-55-0

:

4-(3-Bromo-2-thienyl)-6-methyl-2-pyrimidinamine

Description:
4-(3-Bromo-2-thienyl)-6-methyl-2-pyrimidinamine is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with a thienyl group and a bromine atom. The presence of the bromine atom enhances its reactivity and potential for various chemical transformations. The methyl group at the 6-position of the pyrimidine ring contributes to its overall hydrophobic character, influencing its solubility and interaction with biological systems. This compound may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, which can be explored through various assays. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and thienyl substituents. Overall, 4-(3-Bromo-2-thienyl)-6-methyl-2-pyrimidinamine represents a versatile scaffold for further chemical modifications and applications in drug discovery.
Formula:C9H8BrN3S
InChI:InChI=1S/C9H8BrN3S/c1-5-4-7(13-9(11)12-5)8-6(10)2-3-14-8/h2-4H,1H3,(H2,11,12,13)
InChI key:InChIKey=KUTYUJWSFOAFHN-UHFFFAOYSA-N
SMILES:BrC1=C(SC=C1)C=2C=C(C)N=C(N)N2
Synonyms:
  • 4-(3-Bromo-2-thienyl)-6-methyl-2-pyrimidinamine
  • 2-Pyrimidinamine, 4-(3-bromo-2-thienyl)-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.