CAS 886360-59-4

Methyl 3-(2-amino-4-fluorophenoxy)-2-thiophenecarboxylate

Description:

Methyl 3-(2-amino-4-fluorophenoxy)-2-thiophenecarboxylate, identified by its CAS number 886360-59-4, is a chemical compound characterized by its unique structural features, which include a thiophene ring and an amino-substituted phenoxy group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the fluorine atom can influence its electronic properties, potentially enhancing its reactivity or interaction with biological targets. Methyl esters, like this compound, often display moderate polarity, which can affect their solubility and partitioning in biological systems. Additionally, the amino group may contribute to hydrogen bonding capabilities, influencing the compound's interactions in various chemical environments. Overall, the characteristics of this compound suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activity would require further investigation through experimental studies.

Formula: C₁₂H₁₀FNO₃S

InChI: InChI=1S/C12H10FNO3S/c1-16-12(15)11-10(4-5-18-11)17-9-3-2-7(13)6-8(9)14/h2-6H,14H2,1H3

InChI key: InChIKey=FHXTYBHQCBXILU-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(OC2=C(N)C=C(F)C=C2)C=CS1

Methyl 3-(2-amino-4-fluorophenoxy)thiophene-2-carboxylate

CAS: 886360-59-4

Methyl 3-(2-amino-4-fluorophenoxy)thiophene-2-carboxylate

Purity: ≥95%

Color and Shape: Powder

Molecular weight: 267.28g/mol

Ref: 54-PC10227