CAS 886360-60-7

Methyl 2-(4-formyl-2-nitrophenoxy)benzoate

Description:

Methyl 2-(4-formyl-2-nitrophenoxy)benzoate, identified by its CAS number 886360-60-7, is an organic compound characterized by its ester functional group and the presence of both a nitro and an aldehyde substituent on the aromatic ring. This compound features a methyl ester group, which contributes to its solubility in organic solvents. The nitro group, known for its electron-withdrawing properties, can influence the compound's reactivity and stability, while the aldehyde group can participate in various chemical reactions, such as condensation and reduction. The presence of multiple functional groups suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Additionally, the compound's structural features may impart specific optical or electronic properties, making it of interest in materials science. Overall, Methyl 2-(4-formyl-2-nitrophenoxy)benzoate is a versatile compound with potential utility in various chemical applications, although specific handling and safety measures should be observed due to the presence of the nitro group.

Formula: C₁₅H₁₁NO₆

InChI: InChI=1S/C15H11NO6/c1-21-15(18)11-4-2-3-5-13(11)22-14-7-6-10(9-17)8-12(14)16(19)20/h2-9H,1H3

InChI key: InChIKey=HZHQYQOTHWXLDR-UHFFFAOYSA-N

SMILES: O(C1=C(N(=O)=O)C=C(C=O)C=C1)C2=C(C(OC)=O)C=CC=C2

Synonyms:

• Benzoic acid, 2-(4-formyl-2-nitrophenoxy)-, methyl ester
• Methyl 2-(4-formyl-2-nitrophenoxy)benzoate