CymitQuimica logo

CAS 886360-71-0

:

6-Methyl-3-(2-thienyl)-1,2,4-triazin-5(2H)-one

Description:
6-Methyl-3-(2-thienyl)-1,2,4-triazin-5(2H)-one is a heterocyclic compound characterized by its triazine core, which features a methyl group and a thienyl substituent. The presence of the triazine ring imparts unique chemical properties, including potential reactivity and stability under various conditions. This compound is likely to exhibit moderate solubility in polar organic solvents due to the presence of the thienyl group, which can enhance its interaction with other molecules. The thienyl moiety may also contribute to the compound's electronic properties, potentially making it useful in applications such as pharmaceuticals or agrochemicals. Additionally, the structure suggests that it could participate in various chemical reactions, including nucleophilic substitutions or cycloadditions, depending on the reaction conditions. Its specific applications and biological activity would depend on further studies, including pharmacological evaluations and toxicity assessments. Overall, 6-Methyl-3-(2-thienyl)-1,2,4-triazin-5(2H)-one represents a versatile compound of interest in synthetic and medicinal chemistry.
Formula:C8H7N3OS
InChI:InChI=1S/C8H7N3OS/c1-5-8(12)9-7(11-10-5)6-3-2-4-13-6/h2-4H,1H3,(H,9,11,12)
InChI key:InChIKey=XIRCMTYSHZIXFK-UHFFFAOYSA-N
SMILES:O=C1NC(=NN=C1C)C2=CC=CS2
Synonyms:
  • 6-Methyl-3-(2-thienyl)-1,2,4-triazin-5(2H)-one
  • 1,2,4-Triazin-5(2H)-one, 6-methyl-3-(2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.