CAS 886360-86-7
:Methyl 5-amino-2-[4-(phenylmethyl)-1-piperazinyl]benzoate
Description:
Methyl 5-amino-2-[4-(phenylmethyl)-1-piperazinyl]benzoate, with the CAS number 886360-86-7, is a chemical compound that belongs to the class of benzoate esters. It features a benzoate moiety substituted with an amino group and a piperazine ring, which is further substituted with a phenylmethyl group. This structure suggests potential biological activity, particularly in pharmacology, as piperazine derivatives are often explored for their effects on the central nervous system. The presence of the amino group may enhance solubility and reactivity, while the methyl ester group can influence the compound's lipophilicity and metabolic stability. The compound's molecular structure indicates it may interact with various biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties, such as solubility, melting point, and spectral data, would be essential for further applications in research or drug development.
Formula:C19H23N3O2
InChI:InChI=1S/C19H23N3O2/c1-24-19(23)17-13-16(20)7-8-18(17)22-11-9-21(10-12-22)14-15-5-3-2-4-6-15/h2-8,13H,9-12,14,20H2,1H3
InChI key:InChIKey=FMTNSDJQEQJTID-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(C=CC(N)=C1)N2CCN(CC3=CC=CC=C3)CC2
Synonyms:- Benzoic acid, 5-amino-2-[4-(phenylmethyl)-1-piperazinyl]-, methyl ester
- Methyl 5-amino-2-[4-(phenylmethyl)-1-piperazinyl]benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.