CAS 886360-92-5

5-Bromo-1-[(3-fluorophenyl)methyl]-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid

Description:

5-Bromo-1-[(3-fluorophenyl)methyl]-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carboxylic acid functional group, and halogen substituents. The presence of the bromine atom and the fluorophenyl group contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit properties typical of pyridine derivatives, such as moderate solubility in polar solvents and potential interactions with biological targets due to its acidic nature. The dihydro-2-oxo structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its specific applications may be explored in medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of functional groups that can facilitate interactions with biological molecules. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₃H₉BrFNO₃

InChI: InChI=1S/C13H9BrFNO3/c14-9-5-11(13(18)19)12(17)16(7-9)6-8-2-1-3-10(15)4-8/h1-5,7H,6H2,(H,18,19)

InChI key: InChIKey=QAOFQFBEIXXAKX-UHFFFAOYSA-N

SMILES: C(N1C(=O)C(C(O)=O)=CC(Br)=C1)C2=CC(F)=CC=C2

Synonyms:

• 5-Bromo-1-[(3-fluorophenyl)methyl]-1,2-dihydro-2-oxo-3-pyridinecarboxylic acid
• 3-Pyridinecarboxylic acid, 5-bromo-1-[(3-fluorophenyl)methyl]-1,2-dihydro-2-oxo-

5-Bromo-1-(3-fluorobenzyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid

CAS: 886360-92-5

5-Bromo-1-(3-fluorobenzyl)-2-oxo-1,2-dihydropyridine-3-carboxylic acid

Molecular weight: 326.12g/mol

Ref: 54-PC10282