CAS 886360-94-7

2-Butyl-5-chloro-6-nitrobenzoxazole

Description:

2-Butyl-5-chloro-6-nitrobenzoxazole is an organic compound characterized by its benzoxazole core, which features a butyl group, a chlorine atom, and a nitro group at specific positions on the aromatic ring. This compound typically exhibits a yellow to orange color and is likely to be a solid at room temperature. It is soluble in organic solvents but may have limited solubility in water due to its hydrophobic butyl group. The presence of the nitro group suggests that it may have potential applications in the field of pharmaceuticals or agrochemicals, as nitro-substituted compounds often exhibit biological activity. The chlorine atom can also influence the compound's reactivity and stability, making it a candidate for further chemical modifications. Safety data should be consulted, as halogenated and nitro compounds can pose health and environmental risks. Overall, 2-Butyl-5-chloro-6-nitrobenzoxazole is a compound of interest in synthetic organic chemistry and may have various applications depending on its reactivity and biological properties.

Formula: C₁₁H₁₁ClN₂O₃

InChI: InChI=1S/C11H11ClN2O3/c1-2-3-4-11-13-8-5-7(12)9(14(15)16)6-10(8)17-11/h5-6H,2-4H2,1H3

InChI key: InChIKey=LQMKZPJGVVIHSZ-UHFFFAOYSA-N

SMILES: C(CCC)C1=NC=2C(=CC(N(=O)=O)=C(Cl)C2)O1

Synonyms:

• 2-Butyl-5-chloro-6-nitrobenzoxazole
• Benzoxazole, 2-butyl-5-chloro-6-nitro-
• 2-BUTYL-5-CHLORO-6-NITRO-1,3-BENZOXAZOLE

2-Butyl-5-chloro-6-nitro-1,3-benzoxazole

CAS: 886360-94-7

2-Butyl-5-chloro-6-nitro-1,3-benzoxazole

Purity: ≥95%

Molecular weight: 254.67g/mol

Ref: 54-OR110803