CAS 886361-08-6
:Methyl 4-[4-[bis(acetyloxy)methyl]-2-nitrophenoxy]benzoate
Description:
Methyl 4-[4-[bis(acetyloxy)methyl]-2-nitrophenoxy]benzoate, identified by its CAS number 886361-08-6, is an organic compound characterized by its complex structure, which includes a benzoate moiety and nitrophenoxy groups. This compound features multiple functional groups, including ester and nitro groups, which contribute to its chemical reactivity and potential applications. The presence of acetyloxy groups suggests that it may exhibit specific reactivity patterns, such as esterification or hydrolysis under certain conditions. The nitro group is known for its electron-withdrawing properties, which can influence the compound's overall electronic characteristics and reactivity. Methyl 4-[4-[bis(acetyloxy)methyl]-2-nitrophenoxy]benzoate may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and utility in synthesizing more complex molecules. However, detailed studies on its physical properties, such as solubility, melting point, and stability, would be necessary to fully understand its behavior in different environments.
Formula:C19H17NO9
InChI:InChI=1S/C19H17NO9/c1-11(21)27-19(28-12(2)22)14-6-9-17(16(10-14)20(24)25)29-15-7-4-13(5-8-15)18(23)26-3/h4-10,19H,1-3H3
InChI key:InChIKey=PJDXVUJIKGWDQJ-UHFFFAOYSA-N
SMILES:C(OC(C)=O)(OC(C)=O)C1=CC(N(=O)=O)=C(OC2=CC=C(C(OC)=O)C=C2)C=C1
Synonyms:- Benzoic acid, 4-[4-[bis(acetyloxy)methyl]-2-nitrophenoxy]-, methyl ester
- Methyl 4-[4-[bis(acetyloxy)methyl]-2-nitrophenoxy]benzoate
- METHYL 4-(4-[BIS(ACETYLOXY)METHYL]-2-NITROPHENOXY)BENZENECARBOXYLATE
- (4-(4-(Methoxycarbonyl)phenoxy)-3-nitrophenyl)methylene diacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.