CAS 886361-15-5
:4-(2-Carboxybenzoyl)-1-methyl-1H-pyrrole-2-carboxylic acid
Description:
4-(2-Carboxybenzoyl)-1-methyl-1H-pyrrole-2-carboxylic acid, identified by its CAS number 886361-15-5, is a chemical compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features multiple functional groups, including carboxylic acid groups, which contribute to its acidic properties and potential for hydrogen bonding. The presence of the carboxybenzoyl moiety enhances its reactivity and solubility in polar solvents. It is likely to exhibit interesting photophysical properties due to the conjugated system formed by the pyrrole and aromatic rings, making it potentially useful in applications such as organic electronics, dyes, or pharmaceuticals. Additionally, the compound's structural features suggest it may participate in various chemical reactions, including esterification and amidation, and may also exhibit biological activity, warranting further investigation in medicinal chemistry. Overall, this compound's unique structure and functional groups make it a subject of interest in both synthetic and applied chemistry.
Formula:C14H11NO5
InChI:InChI=1S/C14H11NO5/c1-15-7-8(6-11(15)14(19)20)12(16)9-4-2-3-5-10(9)13(17)18/h2-7H,1H3,(H,17,18)(H,19,20)
InChI key:InChIKey=FMHPKFIOWAEFAT-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C(O)=O)C=CC=C1)C=2C=C(C(O)=O)N(C)C2
Synonyms:- 4-(2-Carboxybenzoyl)-1-methyl-1H-pyrrole-2-carboxylic acid
- 1H-Pyrrole-2-carboxylic acid, 4-(2-carboxybenzoyl)-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.