CAS 886361-18-8
:2,3,4,5,6-Pentafluorophenyl 1-naphthalenesulfonate
Description:
2,3,4,5,6-Pentafluorophenyl 1-naphthalenesulfonate is a chemical compound characterized by its complex structure, which includes a naphthalene moiety and a pentafluorophenyl group. This compound is notable for its high degree of fluorination, which imparts unique properties such as increased lipophilicity and thermal stability. The presence of the sulfonate group enhances its solubility in polar solvents, making it useful in various chemical applications. It is often employed as a reagent in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The fluorinated aromatic system can also influence the electronic properties of the compound, potentially affecting its reactivity and interaction with biological targets. Additionally, due to its specific structural features, it may exhibit interesting photophysical properties, making it a candidate for studies in materials science and photochemistry. Safety and handling precautions should be observed, as with many fluorinated compounds, due to potential toxicity and environmental concerns.
Formula:C16H7F5O3S
InChI:InChI=1S/C16H7F5O3S/c17-11-12(18)14(20)16(15(21)13(11)19)24-25(22,23)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H
InChI key:InChIKey=CIDVIMWPRARGOJ-UHFFFAOYSA-N
SMILES:S(OC1=C(F)C(F)=C(F)C(F)=C1F)(=O)(=O)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- 1-Naphthalenesulfonic acid, 2,3,4,5,6-pentafluorophenyl ester
- 2,3,4,5,6-Pentafluorophenyl 1-naphthalenesulfonate
- 1-Naphthalenesulfonic acid, pentafluorophenyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,3,4,5,6-Pentafluorophenyl 1-naphthalenesulphonate
CAS:<p>2,3,4,5,6-Pentafluorophenyl 1-naphthalenesulphonate</p>Molecular weight:374.28g/mol
