CAS 886361-30-4
:Methyl 2-amino-5-(4-fluorophenyl)-4-thiazolecarboxylate
Description:
Methyl 2-amino-5-(4-fluorophenyl)-4-thiazolecarboxylate, identified by its CAS number 886361-30-4, is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features an amino group and a carboxylate ester, contributing to its potential reactivity and solubility properties. The presence of a fluorophenyl group enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry. The thiazole moiety is often associated with various biological activities, making such compounds of interest in drug development. Additionally, the methyl ester group can affect the compound's stability and reactivity, influencing its interactions in biological systems. Overall, Methyl 2-amino-5-(4-fluorophenyl)-4-thiazolecarboxylate is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C11H9FN2O2S
InChI:InChI=1S/C11H9FN2O2S/c1-16-10(15)8-9(17-11(13)14-8)6-2-4-7(12)5-3-6/h2-5H,1H3,(H2,13,14)
InChI key:InChIKey=QTTYJRKPJUWDJF-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(SC(N)=N1)C2=CC=C(F)C=C2
Synonyms:- 2-Amino-5-(4-fluorophenyl)thiazole-4-carboxylic acid methyl ester
- 4-Thiazolecarboxylic acid, 2-amino-5-(4-fluorophenyl)-, methyl ester
- Methyl 2-amino-5-(4-fluorophenyl)-4-thiazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2-amino-5-(4-fluorophenyl)-1,3-thiazole-4-carboxylate
CAS:Methyl 2-amino-5-(4-fluorophenyl)-1,3-thiazole-4-carboxylate
Molecular weight:252.26g/mol
