CymitQuimica logo

CAS 886361-37-1

:

1-[2-Amino-5-(3-methyl-1-piperidinyl)phenyl]ethanone

Description:
1-[2-Amino-5-(3-methyl-1-piperidinyl)phenyl]ethanone, with the CAS number 886361-37-1, is a chemical compound characterized by its unique structure that includes an ethanone moiety and an amino group attached to a phenyl ring. This compound features a piperidine ring, which contributes to its potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding, influencing its solubility and reactivity. The methyl group on the piperidine ring can affect the steric and electronic properties of the molecule, potentially impacting its interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that could confer specific pharmacological properties. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation through pharmacological studies. As with any chemical substance, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C14H20N2O
InChI:InChI=1S/C14H20N2O/c1-10-4-3-7-16(9-10)12-5-6-14(15)13(8-12)11(2)17/h5-6,8,10H,3-4,7,9,15H2,1-2H3
InChI key:InChIKey=BWFZBTKGMUYYLX-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1C=C(C=CC1N)N2CC(C)CCC2
Synonyms:
  • 1-[2-Amino-5-(3-methyl-1-piperidinyl)phenyl]ethanone
  • Ethanone, 1-[2-amino-5-(3-methyl-1-piperidinyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.