CAS 886361-38-2
:Methyl 2-amino-5-(2-fluorophenyl)-4-thiazolecarboxylate
Description:
Methyl 2-amino-5-(2-fluorophenyl)-4-thiazolecarboxylate, identified by its CAS number 886361-38-2, is a chemical compound that features a thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound is characterized by the presence of an amino group and a methyl ester functional group, contributing to its reactivity and potential biological activity. The 2-fluorophenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. Typically, compounds of this nature are studied for their pharmacological properties, including potential applications in medicinal chemistry. The thiazole moiety is often associated with various biological activities, making such compounds of interest in drug discovery. Additionally, the presence of fluorine can modify the electronic properties of the molecule, potentially affecting its binding affinity and selectivity towards specific receptors or enzymes. Overall, Methyl 2-amino-5-(2-fluorophenyl)-4-thiazolecarboxylate represents a class of compounds that may exhibit significant therapeutic potential.
Formula:C11H9FN2O2S
InChI:InChI=1S/C11H9FN2O2S/c1-16-10(15)8-9(17-11(13)14-8)6-4-2-3-5-7(6)12/h2-5H,1H3,(H2,13,14)
InChI key:InChIKey=BHNURCLYJAQCOH-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(SC(N)=N1)C2=C(F)C=CC=C2
Synonyms:- 4-Thiazolecarboxylic acid, 2-amino-5-(2-fluorophenyl)-, methyl ester
- 2-Amino-5-(2-fluorophenyl)thiazole-4-carboxylic acid methyl ester
- Methyl 2-amino-5-(2-fluorophenyl)-4-thiazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2-amino-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate
CAS:Methyl 2-amino-5-(2-fluorophenyl)-1,3-thiazole-4-carboxylate
Molecular weight:252.26g/mol
