CymitQuimica logo

CAS 886361-40-6

:

Methyl 2-amino-5-(2-chlorophenyl)-4-thiazolecarboxylate

Description:
Methyl 2-amino-5-(2-chlorophenyl)-4-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a methyl ester functional group, contributing to its solubility and reactivity. The presence of the amino group indicates potential for hydrogen bonding and reactivity in various chemical reactions, while the 2-chlorophenyl substituent introduces a halogen, which can influence the compound's biological activity and lipophilicity. The thiazole moiety is often associated with various pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability, reactivity, and interaction with biological systems can be influenced by the electronic effects of the chlorine atom and the overall steric environment. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H9ClN2O2S
InChI:InChI=1S/C11H9ClN2O2S/c1-16-10(15)8-9(17-11(13)14-8)6-4-2-3-5-7(6)12/h2-5H,1H3,(H2,13,14)
InChI key:InChIKey=PYOYAFBTVXWGRD-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(SC(N)=N1)C2=C(Cl)C=CC=C2
Synonyms:
  • Methyl 2-amino-5-(2-chlorophenyl)-4-thiazolecarboxylate
  • 4-Thiazolecarboxylic acid, 2-amino-5-(2-chlorophenyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.