CAS 886361-55-3
:5-[(4-Bromophenyl)thio]-2-thiophenecarboxaldehyde
Description:
5-[(4-Bromophenyl)thio]-2-thiophenecarboxaldehyde is an organic compound characterized by the presence of a thiophene ring and a carboxaldehyde functional group. The compound features a bromophenyl group attached via a thioether linkage, which contributes to its unique chemical properties. The presence of the bromine atom enhances the compound's reactivity and can influence its electronic properties, making it useful in various synthetic applications. The thiophene ring, known for its aromaticity, adds stability and can participate in various chemical reactions, including electrophilic substitutions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for research in medicinal chemistry. Additionally, its solubility and reactivity can vary based on the solvent and conditions used, which is important for its application in organic synthesis and material science. Overall, 5-[(4-Bromophenyl)thio]-2-thiophenecarboxaldehyde is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C11H7BrOS2
InChI:InChI=1S/C11H7BrOS2/c12-8-1-3-9(4-2-8)14-11-6-5-10(7-13)15-11/h1-7H
InChI key:InChIKey=ZEDZPXWJYJFKMB-UHFFFAOYSA-N
SMILES:S(C=1SC(C=O)=CC1)C2=CC=C(Br)C=C2
Synonyms:- 5-[(4-Bromophenyl)thio]-2-thiophenecarboxaldehyde
- 2-Thiophenecarboxaldehyde, 5-[(4-bromophenyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.