CAS 886361-57-5

Ethyl 2-[2-(aminocarbonyl)hydrazinylidene]-3-[(4-chlorophenyl)thio]propanoate

Description:

Ethyl 2-[2-(aminocarbonyl)hydrazinylidene]-3-[(4-chlorophenyl)thio]propanoate is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group, a hydrazine moiety, and a thioether linkage. The presence of the aminocarbonyl group indicates that it has potential for forming hydrogen bonds, which can influence its solubility and reactivity. The 4-chlorophenyl group contributes to the compound's aromatic character, potentially affecting its electronic properties and interactions with biological systems. This compound may exhibit biological activity due to the hydrazine and thioether functionalities, which are often associated with various pharmacological effects. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific properties such as solubility, melting point, and reactivity would require empirical data for precise characterization. Safety and handling considerations should also be taken into account, as compounds containing hydrazine derivatives can be hazardous.

Formula: C₁₂H₁₄ClN₃O₃S

InChI: InChI=1S/C12H14ClN3O3S/c1-2-19-11(17)10(15-16-12(14)18)7-20-9-5-3-8(13)4-6-9/h3-6H,2,7H2,1H3,(H3,14,16,18)

InChI key: InChIKey=PPNOOJMKIGOUHV-UHFFFAOYSA-N

SMILES: C(CSC1=CC=C(Cl)C=C1)(C(OCC)=O)=NNC(N)=O

Synonyms:

• Ethyl 2-[2-(aminocarbonyl)hydrazinylidene]-3-[(4-chlorophenyl)thio]propanoate
• Propanoic acid, 2-[2-(aminocarbonyl)hydrazinylidene]-3-[(4-chlorophenyl)thio]-, ethyl ester
• Propanoic acid, 2-[(aminocarbonyl)hydrazono]-3-[(4-chlorophenyl)thio]-, ethyl ester