CAS 886361-61-1
:4-Chloro-2-[[(4-chlorophenyl)methyl]thio]-6-(methoxymethyl)pyrimidine
Description:
4-Chloro-2-[[(4-chlorophenyl)methyl]thio]-6-(methoxymethyl)pyrimidine is a synthetic organic compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms. The presence of a chloro group at the 4-position and a thioether linkage with a 4-chlorobenzyl group at the 2-position contributes to its unique chemical properties. Additionally, the methoxymethyl substituent at the 6-position enhances its reactivity and solubility in organic solvents. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its structure suggests potential interactions with biological targets, possibly influencing enzyme activity or receptor binding. The compound's molecular weight, solubility, and stability under various conditions would be essential for understanding its practical applications and behavior in biological systems. As with many synthetic compounds, safety data and handling precautions should be considered, particularly regarding its potential toxicity and environmental impact.
Formula:C13H12Cl2N2OS
InChI:InChI=1S/C13H12Cl2N2OS/c1-18-7-11-6-12(15)17-13(16-11)19-8-9-2-4-10(14)5-3-9/h2-6H,7-8H2,1H3
InChI key:InChIKey=IXYPSNVGRZGGDR-UHFFFAOYSA-N
SMILES:S(CC1=CC=C(Cl)C=C1)C=2N=C(COC)C=C(Cl)N2
Synonyms:- 4-Chloro-2-[[(4-chlorophenyl)methyl]thio]-6-(methoxymethyl)pyrimidine
- Pyrimidine, 4-chloro-2-[[(4-chlorophenyl)methyl]thio]-6-(methoxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.