CAS 886361-69-9

2-Fluoro-4-(3-thienyl)benzonitrile

Description:

2-Fluoro-4-(3-thienyl)benzonitrile is an organic compound characterized by its unique structure, which includes a fluorine atom, a thienyl group, and a nitrile functional group. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The thienyl group, derived from thiophene, contributes to the compound's aromatic character and may impart specific electronic properties. The benzonitrile moiety indicates the presence of a cyano group (-C≡N), which can participate in various chemical reactions, including nucleophilic additions and substitutions. This compound may exhibit interesting properties such as fluorescence or specific interactions with biological targets, making it of interest in fields like medicinal chemistry and materials science. Its CAS number, 886361-69-9, allows for precise identification in chemical databases and literature. Overall, 2-Fluoro-4-(3-thienyl)benzonitrile is a versatile compound with potential applications in research and industry, particularly in the development of pharmaceuticals or agrochemicals.

Formula: C₁₁H₆FNS

InChI: InChI=1S/C11H6FNS/c12-11-5-8(1-2-9(11)6-13)10-3-4-14-7-10/h1-5,7H

InChI key: InChIKey=KDGWQDPBKBHHGI-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C#N)C=2C=CSC2

Synonyms:

• 2-Fluoro-4-(3-thienyl)benzonitrile
• Benzonitrile, 2-fluoro-4-(3-thienyl)-