
CAS 886361-77-9
:Ethyl 5-(3-nitrophenyl)-2-thiophenecarboxylate
Description:
Ethyl 5-(3-nitrophenyl)-2-thiophenecarboxylate is an organic compound characterized by its unique structure, which includes a thiophene ring and a nitrophenyl group. This compound typically appears as a yellow to orange solid and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. The presence of the nitro group contributes to its potential as a chromophore, making it useful in various applications, including organic synthesis and materials science. Ethyl 5-(3-nitrophenyl)-2-thiophenecarboxylate may exhibit biological activity, which can be explored for pharmaceutical applications. Its reactivity is influenced by the electron-withdrawing nature of the nitro group, which can affect its behavior in chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Safety precautions should be taken when handling this compound, as nitro compounds can be hazardous. Overall, this compound is of interest in both academic research and industrial applications due to its distinctive chemical properties.
Formula:C13H11NO4S
InChI:InChI=1S/C13H11NO4S/c1-2-18-13(15)12-7-6-11(19-12)9-4-3-5-10(8-9)14(16)17/h3-8H,2H2,1H3
InChI key:InChIKey=MDEHKNURHIOVCI-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1SC(=CC1)C2=CC(N(=O)=O)=CC=C2
Synonyms:- 2-Thiophenecarboxylic acid, 5-(3-nitrophenyl)-, ethyl ester
- Ethyl 5-(3-nitrophenyl)-2-thiophenecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.