CAS 886361-92-8

β-1,3-Benzodioxol-5-yl-1,4-dioxa-8-azaspiro[4.5]decane-8-propanoic acid

Description:

β-1,3-Benzodioxol-5-yl-1,4-dioxa-8-azaspiro[4.5]decane-8-propanoic acid, with the CAS number 886361-92-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a spirocyclic framework. This compound features a benzodioxole moiety, contributing to its potential biological activity and interaction with various biological targets. The presence of the dioxane and azaspiro groups suggests that it may exhibit unique chemical properties, such as stability and reactivity under specific conditions. Additionally, the propanoic acid functional group indicates that it may possess acidic characteristics, which could influence its solubility and interaction with other molecules. Compounds of this nature are often studied for their pharmacological potential, particularly in the fields of medicinal chemistry and drug development. However, detailed studies on its specific biological activity, toxicity, and pharmacokinetics would be necessary to fully understand its applications and safety profile.

Formula: C₁₇H₂₁NO₆

InChI: InChI=1S/C17H21NO6/c19-16(20)10-13(12-1-2-14-15(9-12)22-11-21-14)18-5-3-17(4-6-18)23-7-8-24-17/h1-2,9,13H,3-8,10-11H2,(H,19,20)

InChI key: InChIKey=BFIDUHPIMJZCRB-UHFFFAOYSA-N

SMILES: C(CC(O)=O)(N1CCC2(CC1)OCCO2)C=3C=C4C(=CC3)OCO4

Synonyms:

• 1,4-Dioxa-8-azaspiro[4.5]decane-8-propanoic acid, β-1,3-benzodioxol-5-yl-
• β-1,3-Benzodioxol-5-yl-1,4-dioxa-8-azaspiro[4.5]decane-8-propanoic acid