CymitQuimica logo

CAS 886361-93-9

:

4′-Bromo-4-nitro[1,1′-biphenyl]-2-carboxylic acid

Description:
4′-Bromo-4-nitro[1,1′-biphenyl]-2-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a bromine atom and a nitro group at the para positions of one of the phenyl rings contributes to its reactivity and potential applications in various chemical reactions. The carboxylic acid functional group at the 2-position enhances its acidity and solubility in polar solvents, making it useful in synthetic organic chemistry. This compound may exhibit interesting electronic properties due to the electron-withdrawing effects of the nitro group and the electron-donating characteristics of the carboxylic acid. Additionally, the bromine substituent can serve as a site for further functionalization, allowing for the development of more complex molecules. Overall, 4′-Bromo-4-nitro[1,1′-biphenyl]-2-carboxylic acid is a versatile compound with potential applications in pharmaceuticals, agrochemicals, and materials science.
Formula:C13H8BrNO4
InChI:InChI=1S/C13H8BrNO4/c14-9-3-1-8(2-4-9)11-6-5-10(15(18)19)7-12(11)13(16)17/h1-7H,(H,16,17)
InChI key:InChIKey=WLKHAJFGWSZCJC-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC(N(=O)=O)=C1)C2=CC=C(Br)C=C2
Synonyms:
  • 4′-Bromo-4-nitro[1,1′-biphenyl]-2-carboxylic acid
  • [1,1′-Biphenyl]-2-carboxylic acid, 4′-bromo-4-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.