CAS 886361-95-1

2-(4-Chlorophenoxy)-5-nitrobenzenemethanol

Description:

2-(4-Chlorophenoxy)-5-nitrobenzenemethanol, identified by its CAS number 886361-95-1, is an organic compound characterized by its complex structure, which includes a chlorophenoxy group and a nitro group attached to a benzene ring. This compound typically exhibits a solid state at room temperature and is likely to be soluble in organic solvents due to its aromatic nature. The presence of the chlorophenyl and nitro groups suggests that it may possess interesting electronic properties, potentially making it useful in various chemical applications, including as an intermediate in organic synthesis or in the development of pharmaceuticals. Additionally, the hydroxyl (-OH) group in its structure indicates that it may participate in hydrogen bonding, influencing its reactivity and solubility. Safety data should be consulted for handling and storage, as compounds with nitro and chloro substituents can exhibit varying degrees of toxicity and environmental impact. Overall, this compound's unique functional groups contribute to its potential utility in chemical research and industrial applications.

Formula: C₁₃H₁₀ClNO₄

InChI: InChI=1S/C13H10ClNO4/c14-10-1-4-12(5-2-10)19-13-6-3-11(15(17)18)7-9(13)8-16/h1-7,16H,8H2

InChI key: InChIKey=MVOOLOJTIUWDEW-UHFFFAOYSA-N

SMILES: O(C1=C(CO)C=C(N(=O)=O)C=C1)C2=CC=C(Cl)C=C2

Synonyms:

• 2-(4-Chlorophenoxy)-5-nitrobenzenemethanol
• Benzenemethanol, 2-(4-chlorophenoxy)-5-nitro-