CymitQuimica logo

CAS 886361-99-5

:

2-(2,5-Dichlorophenyl)-2,3-dihydro-1,5-benzothiazepin-4(5H)-one

Description:
2-(2,5-Dichlorophenyl)-2,3-dihydro-1,5-benzothiazepin-4(5H)-one is a chemical compound characterized by its complex structure, which includes a benzothiazepine core. This compound features a dichlorophenyl group, contributing to its unique chemical properties and potential biological activity. The presence of the benzothiazepine moiety suggests that it may exhibit pharmacological effects, as many compounds in this class are known for their activity as calcium channel blockers or in other therapeutic areas. The dihydro form indicates that it has a saturated ring structure, which can influence its reactivity and stability. Additionally, the compound's molecular structure may allow for various interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 886361-99-5, serves as a unique identifier for regulatory and research purposes. Overall, this compound's characteristics suggest potential applications in drug development, although specific biological activities would require further investigation through experimental studies.
Formula:C15H11Cl2NOS
InChI:InChI=1S/C15H11Cl2NOS/c16-9-5-6-11(17)10(7-9)14-8-15(19)18-12-3-1-2-4-13(12)20-14/h1-7,14H,8H2,(H,18,19)
InChI key:InChIKey=JQVCRDQHPXBUGK-UHFFFAOYSA-N
SMILES:ClC1=C(C2SC=3C(NC(=O)C2)=CC=CC3)C=C(Cl)C=C1
Synonyms:
  • 2-(2,5-Dichlorophenyl)-2,3-dihydro-1,5-benzothiazepin-4(5H)-one
  • 1,5-Benzothiazepin-4(5H)-one, 2-(2,5-dichlorophenyl)-2,3-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.