CAS 886362-30-7

5-Amino-1-[(4-bromophenyl)methyl]-1H-1,2,3-triazole-4-carboxamide

Description:

5-Amino-1-[(4-bromophenyl)methyl]-1H-1,2,3-triazole-4-carboxamide is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features an amino group and a carboxamide functional group, contributing to its potential as a bioactive molecule. The presence of the 4-bromophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The triazole moiety is known for its role in various pharmacological activities, including antifungal and anticancer properties. The compound's structure suggests it may participate in hydrogen bonding due to the amino and carboxamide groups, which can affect its solubility and reactivity. Additionally, the bromine substituent can provide unique electronic properties, potentially impacting its biological activity. Overall, this compound's unique structural features make it a subject of interest in medicinal chemistry and drug development.

Formula: C₁₀H₁₀BrN₅O

InChI: InChI=1S/C10H10BrN5O/c11-7-3-1-6(2-4-7)5-16-9(12)8(10(13)17)14-15-16/h1-4H,5,12H2,(H2,13,17)

InChI key: InChIKey=LQCVEULUACPRSY-UHFFFAOYSA-N

SMILES: C(N1C(N)=C(C(N)=O)N=N1)C2=CC=C(Br)C=C2

Synonyms:

• 1H-1,2,3-Triazole-4-carboxamide, 5-amino-1-[(4-bromophenyl)methyl]-
• 5-Amino-1-[(4-bromophenyl)methyl]-1H-1,2,3-triazole-4-carboxamide