CAS 886362-31-8

β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1-[(phenylmethoxy)carbonyl]-2-piperidinepropanoic acid

Description:

The chemical substance known as β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1-[(phenylmethoxy)carbonyl]-2-piperidinepropanoic acid, with the CAS number 886362-31-8, is a synthetic compound primarily utilized in peptide synthesis and drug development. It features a complex structure that includes a piperidine ring, which contributes to its potential biological activity. The presence of fluorenylmethoxycarbonyl (Fmoc) and phenylmethoxycarbonyl (Pmc) groups indicates that it is likely used as a protecting group in the synthesis of amino acids or peptides, facilitating selective reactions while preventing unwanted side reactions. This compound is characterized by its stability under standard laboratory conditions, although it may require specific handling to maintain its integrity. Its solubility properties can vary depending on the solvent used, and it is generally soluble in organic solvents. The compound's unique structure and functional groups suggest potential applications in medicinal chemistry, particularly in the design of novel therapeutic agents.

Formula: C₃₁H₃₂N₂O₆

InChI: InChI=1S/C31H32N2O6/c34-29(35)18-27(28-16-8-9-17-33(28)31(37)39-19-21-10-2-1-3-11-21)32-30(36)38-20-26-24-14-6-4-12-22(24)23-13-5-7-15-25(23)26/h1-7,10-15,26-28H,8-9,16-20H2,(H,32,36)(H,34,35)

InChI key: InChIKey=YZKHTBWOPFULRK-UHFFFAOYSA-N

SMILES: C(OC(NC(CC(O)=O)C1N(C(OCC2=CC=CC=C2)=O)CCCC1)=O)C3C=4C(C=5C3=CC=CC5)=CC=CC4

Synonyms:

• 2-Piperidinepropanoic acid, β-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-1-[(phenylmethoxy)carbonyl]-
• β-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-1-[(phenylmethoxy)carbonyl]-2-piperidinepropanoic acid

N-Fmoc-3-(1-Cbz-Piperidin-2-yl)-β-DL-alanine

CAS: 886362-31-8

Molecular weight: 528.6

Ref: 7W-GM9229