CAS 886362-39-6

Ethyl β-amino-1-[(phenylmethoxy)carbonyl]-2-piperidinepropanoate

Description:

Ethyl β-amino-1-[(phenylmethoxy)carbonyl]-2-piperidinepropanoate is a chemical compound characterized by its complex structure, which includes a piperidine ring, an ethyl ester group, and a phenylmethoxycarbonyl moiety. This compound typically exhibits properties associated with both amines and esters, such as moderate solubility in organic solvents and potential reactivity due to the presence of the amino group. The piperidine ring contributes to its cyclic structure, which can influence its biological activity and interactions. The phenylmethoxycarbonyl group may enhance lipophilicity, affecting its pharmacokinetic properties. As a compound with potential applications in medicinal chemistry, it may serve as a precursor or intermediate in the synthesis of pharmaceuticals, particularly those targeting the central nervous system or other biological pathways. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical and pharmaceutical applications.

Formula: C₁₈H₂₆N₂O₄

InChI: InChI=1S/C18H26N2O4/c1-2-23-17(21)12-15(19)16-10-6-7-11-20(16)18(22)24-13-14-8-4-3-5-9-14/h3-5,8-9,15-16H,2,6-7,10-13,19H2,1H3

InChI key: InChIKey=LMHWUCOFJHJIFA-UHFFFAOYSA-N

SMILES: C(OCC1=CC=CC=C1)(=O)N2C(C(CC(OCC)=O)N)CCCC2

Synonyms:

• 2-Piperidinepropanoic acid, β-amino-1-[(phenylmethoxy)carbonyl]-, ethyl ester
• Ethyl β-amino-1-[(phenylmethoxy)carbonyl]-2-piperidinepropanoate