CymitQuimica logo

CAS 886362-48-7

:

N-(4-cyanophenyl)-2-(4-hydroxyphenyl)acetamide

Description:
N-(4-cyanophenyl)-2-(4-hydroxyphenyl)acetamide, with the CAS number 886362-48-7, is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a cyanophenyl group and a hydroxyphenyl group, contributing to its potential biological activity and chemical reactivity. The presence of the cyanide group may impart unique electronic properties, while the hydroxy group can participate in hydrogen bonding, influencing solubility and interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential anti-inflammatory or analgesic effects. The molecular structure suggests that it may exhibit moderate lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the compound's stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended applications. Overall, N-(4-cyanophenyl)-2-(4-hydroxyphenyl)acetamide represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C15H12N2O2
InChI:InChI=1/C15H12N2O2/c16-10-12-1-5-13(6-2-12)17-15(19)9-11-3-7-14(18)8-4-11/h1-8,18H,9H2,(H,17,19)
SMILES:c1cc(ccc1C#N)NC(=O)Cc1ccc(cc1)O
Synonyms:
  • Benzeneacetamide, N-(4-cyanophenyl)-4-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.