CAS 886362-75-0
:4-chloro-6,7-difluoro-quinoline-3-carbonitrile
Description:
4-Chloro-6,7-difluoro-quinoline-3-carbonitrile is a heterocyclic organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of chlorine and fluorine substituents at the 4 and 6,7 positions, respectively, contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The carbonitrile functional group at the 3-position enhances its reactivity and may influence its interactions in various chemical environments. This compound is typically used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its molecular structure allows for potential applications in medicinal chemistry, where modifications can lead to compounds with desired therapeutic effects. Additionally, the presence of halogens can affect the compound's stability, solubility, and overall reactivity, making it a subject of interest in both synthetic and medicinal chemistry. As with many fluorinated compounds, it may exhibit unique properties such as increased metabolic stability and altered pharmacokinetics.
Formula:C10H3ClF2N2
InChI:InChI=1/C10H3ClF2N2/c11-10-5(3-14)4-15-9-2-8(13)7(12)1-6(9)10/h1-2,4H
SMILES:c1c2c(cc(c1F)F)ncc(C#N)c2Cl
Synonyms:- 3-Quinolinecarbonitrile, 4-chloro-6,7-difluoro-
- 4-Chloro-6,7-Difluoroquinoline-3-Carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
