CAS 886362-90-9
:3-[2-(3-ethoxy-3-oxo-propoxy)ethoxy]propanoic acid
Description:
3-[2-(3-ethoxy-3-oxo-propoxy)ethoxy]propanoic acid, with the CAS number 886362-90-9, is a chemical compound characterized by its complex structure that includes multiple functional groups. It features a propanoic acid moiety, which contributes to its acidity and potential reactivity. The presence of ethoxy groups suggests that the compound may exhibit solubility in organic solvents and could participate in various chemical reactions, such as esterification or ether formation. The oxo group indicates the presence of a carbonyl, which can influence the compound's reactivity and interactions with other molecules. This compound may be of interest in fields such as medicinal chemistry or materials science due to its potential applications in drug development or as a building block in polymer synthesis. Its specific properties, such as melting point, boiling point, and solubility, would require empirical measurement or detailed computational analysis for precise characterization. Overall, the structural complexity of this compound suggests diverse chemical behavior and potential utility in various applications.
Formula:C10H18O6
InChI:InChI=1/C10H18O6/c1-2-16-10(13)4-6-15-8-7-14-5-3-9(11)12/h2-8H2,1H3,(H,11,12)
SMILES:CCOC(=O)CCOCCOCCC(=O)O
Synonyms:- 3-[2-(3-Ethoxy-3-oxopropoxy)ethoxy]propanoic acid
- 3-[2-(2-Ethoxycarbonyl-Ethoxy)-Ethoxy]-Propionic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-(2-(3-Ethoxy-3-oxopropoxy)ethoxy)propanoic acid
CAS:Formula:C10H18O6Purity:97%Color and Shape:LiquidMolecular weight:234.24633-[2-(2-Ethoxycarbonyl-ethoxy)-ethoxy]-propionic acid
CAS:3-[2-(2-Ethoxycarbonyl-ethoxy)-ethoxy]-propionic acidPurity:97%Molecular weight:234.25g/mol3-[2-(2-Ethoxycarbonyl-ethoxy)-ethoxy]-propionic acid
CAS:Formula:C10H18O6Purity:97%Color and Shape:LiquidMolecular weight:234.2483-[2-(2-Ethoxycarbonyl-ethoxy)-ethoxy]-propionic acid
CAS:<p>Versatile small molecule scaffold</p>Formula:C10H18O6Purity:Min. 95%Molecular weight:234.25 g/molAcid-PEG2-ethyl propionate
CAS:<p>Acid-PEG2-ethyl propionate is a valuable organic compound for life sciences research (catalog number: T66862, CAS number: 886362-90-9).</p>Formula:C10H18O6Color and Shape:SolidMolecular weight:234.248




