CAS 886362-93-2

2-Hydroxy-2-(3-pyridinyl)cyclohexanone

Description:

2-Hydroxy-2-(3-pyridinyl)cyclohexanone, identified by its CAS number 886362-93-2, is an organic compound characterized by a cyclohexanone structure with a hydroxyl group and a pyridine ring. This compound features a cyclohexane ring that is substituted with a hydroxyl (-OH) group at the second carbon and a pyridine moiety at the same carbon, contributing to its unique chemical properties. The presence of the hydroxyl group suggests that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The pyridine ring, being aromatic, adds to the compound's stability and can participate in various chemical interactions, including coordination with metal ions. This compound may be of interest in medicinal chemistry due to its potential biological activity, particularly in relation to its structural similarity to other pharmacologically active compounds. Its properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 2-Hydroxy-2-(3-pyridinyl)cyclohexanone represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₁H₁₃NO₂

InChI: InChI=1S/C11H13NO2/c13-10-5-1-2-6-11(10,14)9-4-3-7-12-8-9/h3-4,7-8,14H,1-2,5-6H2

InChI key: InChIKey=JXCDTKJBXRBNQN-UHFFFAOYSA-N

SMILES: OC1(C(=O)CCCC1)C=2C=CC=NC2

Synonyms:

• 2-Hydroxy-2-(3-pyridinyl)cyclohexanone
• 2-Hydroxy-2-pyridin-3-ylcyclohexan-1-one
• 2-Hydroxy-2-(pyridin-3-yl)cyclohexanone
• Cyclohexanone, 2-hydroxy-2-(3-pyridinyl)-