CAS 886362-97-6

Carbamic acid, [2-hydroxy-1-(1-pyrrolidinylmethyl)propyl]methyl-, phenylmethyl ester

Description:

Carbamic acid, [2-hydroxy-1-(1-pyrrolidinylmethyl)propyl]methyl-, phenylmethyl ester, identified by CAS number 886362-97-6, is a chemical compound that features a carbamate functional group. This compound is characterized by its complex structure, which includes a pyrrolidine ring, a hydroxyl group, and an ester linkage. The presence of the pyrrolidine moiety suggests potential biological activity, as pyrrolidine derivatives are often associated with various pharmacological properties. The compound is likely to be a white to off-white solid, soluble in organic solvents, and may exhibit moderate stability under standard conditions. Its chemical properties may include reactivity towards nucleophiles due to the electrophilic nature of the carbonyl carbon in the carbamate group. Additionally, the presence of the phenylmethyl group may influence its lipophilicity and interaction with biological systems. Overall, this compound's unique structure and functional groups suggest potential applications in medicinal chemistry and drug development, although specific biological activities would require further investigation.

Formula: C₁₇H₂₆N₂O₃

InChI: InChI=1S/C17H26N2O3/c1-14(20)16(12-19-10-6-7-11-19)18(2)17(21)22-13-15-8-4-3-5-9-15/h3-5,8-9,14,16,20H,6-7,10-13H2,1-2H3

InChI key: InChIKey=CTTIQIOTCUBWFN-UHFFFAOYSA-N

SMILES: C(CN1CCCC1)(N(C(OCC2=CC=CC=C2)=O)C)C(C)O

Synonyms:

• Carbamic acid, [2-hydroxy-1-(1-pyrrolidinylmethyl)propyl]methyl-, phenylmethyl ester