
CAS 886363-04-8
:Phenylmethyl 4-(phenylmethoxy)-2-(1-pyrrolidinylmethyl)-1-pyrrolidinecarboxylate
Description:
Phenylmethyl 4-(phenylmethoxy)-2-(1-pyrrolidinylmethyl)-1-pyrrolidinecarboxylate, identified by its CAS number 886363-04-8, is a synthetic organic compound that belongs to the class of pyrrolidine derivatives. This compound features a complex structure characterized by multiple functional groups, including ester and ether linkages, which contribute to its chemical reactivity and potential biological activity. The presence of pyrrolidine rings suggests that it may exhibit properties relevant to pharmacology, possibly interacting with neurotransmitter systems. Its molecular structure indicates potential lipophilicity, which could influence its solubility and permeability in biological systems. Additionally, the presence of phenyl groups may enhance its stability and provide opportunities for further chemical modifications. While specific data on its physical properties, such as melting point or solubility, may not be readily available, compounds of this nature are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development. Further research would be necessary to elucidate its full range of characteristics and potential uses.
Formula:C24H30N2O3
InChI:InChI=1S/C24H30N2O3/c27-24(29-19-21-11-5-2-6-12-21)26-17-23(28-18-20-9-3-1-4-10-20)15-22(26)16-25-13-7-8-14-25/h1-6,9-12,22-23H,7-8,13-19H2
InChI key:InChIKey=RWSANADENYLJKX-UHFFFAOYSA-N
SMILES:C(C1N(C(OCC2=CC=CC=C2)=O)CC(OCC3=CC=CC=C3)C1)N4CCCC4
Synonyms:- 1-Pyrrolidinecarboxylic acid, 4-(phenylmethoxy)-2-(1-pyrrolidinylmethyl)-, phenylmethyl ester
- Phenylmethyl 4-(phenylmethoxy)-2-(1-pyrrolidinylmethyl)-1-pyrrolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Pyrrolidinecarboxylicacid, 4-(phenylmethoxy)-2-(1-pyrrolidinylmethyl)-, phenylmethyl ester
CAS:Formula:C24H30N2O3Molecular weight:394.5066
