CAS 886363-05-9

N,7-Dimethylimidazo[1,2-a]pyridine-2-methanamine

Description:

N,7-Dimethylimidazo[1,2-a]pyridine-2-methanamine is a chemical compound that belongs to the class of imidazo[1,2-a]pyridines, which are heterocyclic aromatic compounds. This substance features a fused ring structure that includes both imidazole and pyridine components, contributing to its unique chemical properties. The presence of two methyl groups at the nitrogen positions (N and 7) and a methanamine group at the 2-position enhances its reactivity and solubility in various solvents. This compound is of interest in the field of medicinal chemistry and toxicology, particularly due to its potential biological activities and implications in carcinogenic studies. Its molecular structure allows for various interactions with biological systems, making it a subject of research in understanding its effects and mechanisms of action. As with many heterocyclic compounds, it may exhibit diverse pharmacological properties, but specific biological activities would require further investigation through empirical studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity.

Formula: C₁₀H₁₃N₃

InChI: InChI=1S/C10H13N3/c1-8-3-4-13-7-9(6-11-2)12-10(13)5-8/h3-5,7,11H,6H2,1-2H3

InChI key: InChIKey=FNEFJAHQRCNWDU-UHFFFAOYSA-N

SMILES: C(NC)C=1N=C2N(C1)C=CC(C)=C2

Synonyms:

• Imidazo[1,2-a]pyridine-2-methanamine, N,7-dimethyl-
• N,7-Dimethylimidazo[1,2-a]pyridine-2-methanamine