CAS 886363-11-7

3′-Amino[1,1′-biphenyl]-3-acetic acid

Description:

3′-Amino[1,1′-biphenyl]-3-acetic acid, identified by its CAS number 886363-11-7, is an organic compound characterized by the presence of an amino group and an acetic acid moiety attached to a biphenyl structure. This compound features a biphenyl backbone, which consists of two phenyl rings connected by a single bond, providing it with unique electronic and steric properties. The amino group (-NH2) contributes to its potential as a building block in pharmaceuticals and organic synthesis, while the acetic acid group (-COOH) imparts acidic characteristics, allowing for potential interactions in biological systems. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its structural features may influence its biological activity, making it of interest in medicinal chemistry. Overall, 3′-Amino[1,1′-biphenyl]-3-acetic acid represents a versatile compound with applications in various fields, including drug development and materials science.

Formula: C₁₄H₁₃NO₂

InChI: InChI=1S/C14H13NO2/c15-13-6-2-5-12(9-13)11-4-1-3-10(7-11)8-14(16)17/h1-7,9H,8,15H2,(H,16,17)

InChI key: InChIKey=WUWAEOOQQHLCRJ-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1C=C(C=CC1)C2=CC(N)=CC=C2

Synonyms:

• 3′-Amino[1,1′-biphenyl]-3-acetic acid
• [1,1'-Biphenyl]-3-acetic acid, 3'-amino-

(3'-Amino-biphenyl-3-yl)-acetic acid

CAS: 886363-11-7

Formula: C₁₄H₁₃NO₂

Molecular weight: 227.2585

Ref: IN-DA008AJN

3-Biphenyl-3′-amino-acetic acid

CAS: 886363-11-7

Formula: C₁₄H₁₃NO₂

Purity: 97.0%

Color and Shape: Solid

Molecular weight: 227.263

Ref: 10-F040738