CymitQuimica logo

CAS 886363-17-3

:

2-(1H-Indol-5-yl)benzoic acid

Description:
2-(1H-Indol-5-yl)benzoic acid, with the CAS number 886363-17-3, is an organic compound characterized by its dual aromatic structure, which includes an indole moiety and a benzoic acid functional group. This compound typically exhibits properties associated with both indole and benzoic acid derivatives, such as moderate solubility in organic solvents and potential for hydrogen bonding due to the carboxylic acid group. The presence of the indole ring suggests potential biological activity, as indole derivatives are often found in pharmaceuticals and natural products. The compound may also display interesting electronic properties due to the conjugation between the indole and benzoic acid structures, which can influence its reactivity and interactions in various chemical environments. Additionally, it may participate in various chemical reactions, including esterification and amidation, making it a valuable intermediate in organic synthesis. Overall, 2-(1H-Indol-5-yl)benzoic acid is a compound of interest in both synthetic chemistry and medicinal chemistry research.
Formula:C15H11NO2
InChI:InChI=1S/C15H11NO2/c17-15(18)13-4-2-1-3-12(13)10-5-6-14-11(9-10)7-8-16-14/h1-9,16H,(H,17,18)
InChI key:InChIKey=PKGXRKSYWVXMKT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC=C1)C=2C=C3C(=CC2)NC=C3
Synonyms:
  • Benzoic acid, 2-(1H-indol-5-yl)-
  • 2-(1H-Indol-5-yl)benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.