CAS 886363-19-5
:2-(1H-Indol-5-yl)benzeneacetic acid
Description:
2-(1H-Indol-5-yl)benzeneacetic acid, also known by its CAS number 886363-19-5, is an organic compound characterized by its unique structure that combines an indole moiety with a benzeneacetic acid functional group. This compound typically exhibits properties associated with both indole and aromatic carboxylic acids, such as moderate solubility in organic solvents and potential interactions with biological systems due to its aromatic nature. It may display biological activity, making it of interest in pharmaceutical research, particularly in the context of drug development. The presence of the indole ring suggests potential for interactions with various biological targets, including receptors and enzymes. Additionally, the carboxylic acid group can participate in hydrogen bonding and ionic interactions, influencing its reactivity and solubility. Overall, 2-(1H-Indol-5-yl)benzeneacetic acid is a compound of interest in medicinal chemistry, with potential applications in therapeutic agents or as a biochemical probe.
Formula:C16H13NO2
InChI:InChI=1S/C16H13NO2/c18-16(19)10-11-3-1-2-4-14(11)12-5-6-15-13(9-12)7-8-17-15/h1-9,17H,10H2,(H,18,19)
InChI key:InChIKey=CUEJHYHGUMAGBP-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=C(C=2C=C3C(=CC2)NC=C3)C=CC=C1
Synonyms:- 2-(1H-Indol-5-yl)benzeneacetic acid
- Benzeneacetic acid, 2-(1H-indol-5-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
