CAS 886363-22-0
:5-(Bromomethyl)-3-(2-bromophenyl)isoxazole
Description:
5-(Bromomethyl)-3-(2-bromophenyl)isoxazole is a chemical compound characterized by its isoxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen atoms. The presence of bromomethyl and 2-bromophenyl substituents indicates that the compound has significant bromine content, which can influence its reactivity and potential applications in organic synthesis or medicinal chemistry. The isoxazole moiety is known for its biological activity, making such compounds of interest in drug development. The compound's molecular structure suggests it may exhibit properties such as lipophilicity due to the aromatic bromophenyl group, which can enhance its interaction with biological targets. Additionally, the bromine atoms can serve as sites for further chemical modifications, allowing for the synthesis of derivatives with varied properties. Overall, this compound's unique structure and substituents position it as a potentially valuable entity in research and development within the fields of pharmaceuticals and agrochemicals.
Formula:C10H7Br2NO
InChI:InChI=1S/C10H7Br2NO/c11-6-7-5-10(13-14-7)8-3-1-2-4-9(8)12/h1-5H,6H2
InChI key:InChIKey=XVDUTFZBEOTWSR-UHFFFAOYSA-N
SMILES:BrC1=C(C=2C=C(CBr)ON2)C=CC=C1
Synonyms:- Isoxazole, 5-(bromomethyl)-3-(2-bromophenyl)-
- 5-(Bromomethyl)-3-(2-bromophenyl)isoxazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
