CAS 886363-33-3

2-[2-(3,4-difluorophenyl)phenyl]acetic acid

Description:

2-[2-(3,4-difluorophenyl)phenyl]acetic acid, identified by its CAS number 886363-33-3, is an organic compound characterized by its unique molecular structure, which includes a phenyl ring substituted with a difluorophenyl group and an acetic acid functional group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities, such as moderate solubility in polar solvents and potential for hydrogen bonding due to the carboxylic acid group. The presence of fluorine atoms in the structure can influence its electronic properties, potentially enhancing lipophilicity and altering reactivity. As a result, this compound may exhibit interesting biological activities, making it a subject of interest in pharmaceutical research. Its synthesis and characterization would involve standard organic chemistry techniques, including purification methods like recrystallization or chromatography. Overall, 2-[2-(3,4-difluorophenyl)phenyl]acetic acid represents a complex molecule with potential applications in medicinal chemistry and material science.

Formula: C₁₄H₁₀F₂O₂

InChI: InChI=1/C14H10F2O2/c15-12-6-5-10(7-13(12)16)11-4-2-1-3-9(11)8-14(17)18/h1-7H,8H2,(H,17,18)

SMILES: c1ccc(c(c1)CC(=O)O)c1ccc(c(c1)F)F

Synonyms:

• (3',4'-Difluorobiphenyl-2-yl)acetic acid
• [1,1'-Biphenyl]-2-acetic acid, 3',4'-difluoro-

2-(3',4'-Difluoro-[1,1'-biphenyl]-2-yl)acetic acid

CAS: 886363-33-3

Formula: C₁₄H₁₀F₂O₂

Purity: 97%

Molecular weight: 248.2248

Ref: IN-DA004AP3

2-Biphenyl-3′,4′-difluoro-acetic acid

CAS: 886363-33-3

Formula: C₁₄H₁₀F₂O₂

Purity: 97%

Molecular weight: 248.229

Ref: 10-F040918