
CAS 886363-48-0
:Ethyl 2-[4-[[(1,1-dimethylethoxy)carbonyl]amino]phenyl]-4-oxazolecarboxylate
Description:
Ethyl 2-[4-[[(1,1-dimethylethoxy)carbonyl]amino]phenyl]-4-oxazolecarboxylate, identified by its CAS number 886363-48-0, is a chemical compound that features a complex structure incorporating an oxazole ring, an ethyl ester group, and an amino substituent. This compound is characterized by its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique functional groups that may interact with biological targets. The presence of the oxazole ring contributes to its aromatic properties, while the ethyl ester enhances its solubility in organic solvents. The dimethylethoxycarbonyl group provides steric hindrance, which can influence the compound's reactivity and biological activity. Overall, this compound exemplifies the intricate design often found in drug development, where specific structural features are tailored to optimize efficacy and selectivity in therapeutic applications. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties would be further explored through various analytical methods to assess its potential uses.
Formula:C17H20N2O5
InChI:InChI=1S/C17H20N2O5/c1-5-22-15(20)13-10-23-14(19-13)11-6-8-12(9-7-11)18-16(21)24-17(2,3)4/h6-10H,5H2,1-4H3,(H,18,21)
InChI key:InChIKey=VLBIXPFOQCCDHS-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1N=C(OC1)C2=CC=C(NC(OC(C)(C)C)=O)C=C2
Synonyms:- Ethyl2-(4-((tert-Butoxycarbonyl)amino)phenyl)oxazole-4-carboxylate
- 4-Oxazolecarboxylic acid, 2-[4-[[(1,1-dimethylethoxy)carbonyl]amino]phenyl]-, ethyl ester
- Ethyl 2-[4-[[(1,1-dimethylethoxy)carbonyl]amino]phenyl]-4-oxazolecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 2-(4-((tert-butoxycarbonyl)amino)phenyl)oxazole-4-carboxylate
CAS:Formula:C17H20N2O5Molecular weight:332.3511

