CAS 886363-58-2

N-[3-(aminomethyl)phenyl]-2-(4-hydroxyphenyl)acetamide

Description:

N-[3-(aminomethyl)phenyl]-2-(4-hydroxyphenyl)acetamide, also known by its CAS number 886363-58-2, is a chemical compound characterized by its amide functional group and the presence of both amino and hydroxy substituents on aromatic rings. This compound features a phenyl ring with an aminomethyl group, which enhances its potential for hydrogen bonding and reactivity. The hydroxyphenyl moiety contributes to its solubility in polar solvents and may influence its biological activity. The presence of both amino and hydroxy groups suggests that this compound could participate in various chemical interactions, making it of interest in medicinal chemistry and drug development. Its structural features may also indicate potential applications in areas such as anti-inflammatory or analgesic therapies, although specific biological activities would require further investigation. Overall, the compound's unique structure and functional groups position it as a candidate for further research in pharmaceutical applications.

Formula: C₁₅H₁₆N₂O₂

InChI: InChI=1/C15H16N2O2/c16-10-12-2-1-3-13(8-12)17-15(19)9-11-4-6-14(18)7-5-11/h1-8,18H,9-10,16H2,(H,17,19)

SMILES: c1cc(cc(c1)N=C(Cc1ccc(cc1)O)O)CN

Synonyms:

• Benzeneacetamide, N-[3-(aminomethyl)phenyl]-4-hydroxy-
• N-[3-(Aminomethyl)phenyl]-2-(4-hydroxyphenyl)acetamide

N-(3-AMINOMETHYL-PHENYL)-2-(4-HYDROXY-PHENYL)-ACETAMIDE

CAS: 886363-58-2

Formula: C₁₅H₁₆N₂O₂

Molecular weight: 256.2997

Ref: IN-DA004AOZ

N-(3-Aminomethyl-phenyl)-2-(4-hydroxy-phenyl)-acetamide

CAS: 886363-58-2

Formula: C₁₅H₁₆N₂O₂

Purity: 97.0%

Molecular weight: 256.305

Ref: 10-F040970