CymitQuimica logo

CAS 886363-64-0

:

4-[4-(Bromomethyl)-2-thiazolyl]phenol

Description:
4-[4-(Bromomethyl)-2-thiazolyl]phenol, identified by its CAS number 886363-64-0, is an organic compound characterized by its phenolic structure combined with a thiazole ring. This compound features a bromomethyl group attached to the thiazole, which enhances its reactivity and potential applications in various chemical reactions. The presence of the hydroxyl (-OH) group in the phenol moiety contributes to its solubility in polar solvents and its ability to participate in hydrogen bonding. The thiazole ring, known for its biological activity, may impart antimicrobial or antifungal properties to the compound. Additionally, the bromomethyl group can serve as a versatile functional handle for further chemical modifications, making it useful in synthetic organic chemistry. Overall, this compound's unique structural features suggest potential applications in pharmaceuticals, agrochemicals, and materials science, although specific applications would depend on further research and development.
Formula:C10H8BrNOS
InChI:InChI=1S/C10H8BrNOS/c11-5-8-6-14-10(12-8)7-1-3-9(13)4-2-7/h1-4,6,13H,5H2
InChI key:InChIKey=LLHPIBMFWMKMCH-UHFFFAOYSA-N
SMILES:C(Br)C=1N=C(SC1)C2=CC=C(O)C=C2
Synonyms:
  • 4-[4-(Bromomethyl)-2-thiazolyl]phenol
  • Phenol, 4-[4-(bromomethyl)-2-thiazolyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.