CymitQuimica logo

CAS 886363-65-1

:

5-methoxyisoxazole-4-carboxylic acid

Description:
5-Methoxyisoxazole-4-carboxylic acid is a heterocyclic organic compound characterized by its isoxazole ring structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of a methoxy group (-OCH3) at the 5-position and a carboxylic acid group (-COOH) at the 4-position contributes to its chemical reactivity and solubility properties. This compound is typically a white to off-white solid and is soluble in polar solvents due to the carboxylic acid functionality. It may exhibit biological activity, making it of interest in pharmaceutical research. The compound's molecular structure allows for potential interactions with various biological targets, and it may be utilized in the synthesis of other chemical entities. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Proper handling and storage conditions are essential to maintain its integrity and effectiveness in research applications.
Formula:C5H5NO4
InChI:InChI=1/C5H5NO4/c1-9-5-3(4(7)8)2-6-10-5/h2H,1H3,(H,7,8)
SMILES:COc1c(cno1)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.