CAS 886363-67-3
:1-morpholino-3-piperazin-1-yl-propan-1-one
Description:
1-Morpholino-3-piperazin-1-yl-propan-1-one, identified by its CAS number 886363-67-3, is a chemical compound that features a morpholine ring and a piperazine moiety, which contribute to its unique properties. This substance is characterized by its potential as a pharmacological agent, often explored for its activity in medicinal chemistry. The presence of both morpholino and piperazine groups suggests it may exhibit good solubility in polar solvents and could interact favorably with biological targets due to its ability to form hydrogen bonds. The compound's structure indicates it may possess basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions. Additionally, its molecular configuration may influence its pharmacokinetic properties, such as absorption and distribution in biological systems. While specific biological activities and applications may vary, compounds of this nature are often investigated for their roles in drug development, particularly in the fields of neuropharmacology and psychiatry.
Formula:C11H21N3O2
InChI:InChI=1/C11H21N3O2/c15-11(14-7-9-16-10-8-14)1-4-13-5-2-12-3-6-13/h12H,1-10H2
SMILES:C(CN1CCNCC1)C(=O)N1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
