CAS 886363-77-5
:3-acetamido-3-(3-chlorophenyl)propanoic acid
Description:
3-Acetamido-3-(3-chlorophenyl)propanoic acid is an organic compound characterized by its structural features, which include an acetamido group and a chlorophenyl moiety attached to a propanoic acid backbone. This compound typically exhibits properties associated with both amides and carboxylic acids, such as the ability to form hydrogen bonds due to the presence of the amide and carboxylic acid functional groups. The chlorophenyl group introduces a degree of hydrophobicity and can influence the compound's reactivity and solubility in various solvents. The presence of the chlorine atom can also affect the electronic properties of the molecule, potentially enhancing its biological activity or interaction with other chemical species. In terms of applications, compounds like this may be explored in pharmaceutical research, particularly for their potential therapeutic effects. Overall, the unique combination of functional groups in 3-acetamido-3-(3-chlorophenyl)propanoic acid contributes to its chemical behavior and potential utility in various chemical and biological contexts.
Formula:C11H12ClNO3
InChI:InChI=1/C11H12ClNO3/c1-7(14)13-10(6-11(15)16)8-3-2-4-9(12)5-8/h2-5,10H,6H2,1H3,(H,13,14)(H,15,16)
SMILES:CC(=NC(CC(=O)O)c1cccc(c1)Cl)O
Synonyms:- Benzenepropanoic acid, β-(acetylamino)-3-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
