CAS 886363-79-7
:2-(Chloromethyl)-4H-pyrido[2,3-d][1,3]oxazin-4-one
Description:
2-(Chloromethyl)-4H-pyrido[2,3-d][1,3]oxazin-4-one is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and an oxazine moiety. This compound features a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. The presence of the oxazinone functional group contributes to its stability and may influence its biological activity. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential pharmacological properties, including antimicrobial or anticancer activities. The molecular structure allows for various interactions with biological targets, making it a candidate for drug development. Additionally, the compound's solubility, melting point, and reactivity can vary based on the substituents and the overall molecular framework. As with many heterocycles, the electronic properties imparted by the nitrogen and oxygen atoms can affect its behavior in chemical reactions and interactions with other molecules. Overall, 2-(Chloromethyl)-4H-pyrido[2,3-d][1,3]oxazin-4-one represents a class of compounds with significant potential in synthetic and medicinal chemistry.
Formula:C8H5ClN2O2
InChI:InChI=1S/C8H5ClN2O2/c9-4-6-11-7-5(8(12)13-6)2-1-3-10-7/h1-3H,4H2
InChI key:InChIKey=GMJFGFVMJBBTLQ-UHFFFAOYSA-N
SMILES:O=C1C=2C(N=C(CCl)O1)=NC=CC2
Synonyms:- 2-(Chloromethyl)-4H-pyrido[2,3-d][1,3]oxazin-4-one
- 4H-pyrido[2,3-d][1,3]oxazin-4-one, 2-(chloromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
