CAS 886363-81-1
:3-(4-amino-1-piperidyl)-1-(6-chloro-3-pyridyl)propan-1-one
Description:
3-(4-amino-1-piperidyl)-1-(6-chloro-3-pyridyl)propan-1-one, identified by its CAS number 886363-81-1, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyridine moiety. This compound features an amino group that enhances its potential for biological activity, making it of interest in medicinal chemistry. The presence of the chloro substituent on the pyridine ring may influence its pharmacological properties, such as lipophilicity and receptor binding affinity. Typically, compounds like this are evaluated for their potential as therapeutic agents, particularly in the context of neurological or psychiatric disorders, due to the piperidine structure's common occurrence in various pharmaceuticals. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. Overall, 3-(4-amino-1-piperidyl)-1-(6-chloro-3-pyridyl)propan-1-one represents a class of compounds that may exhibit significant biological activity, warranting further investigation in drug development.
Formula:C13H18ClN3O
InChI:InChI=1/C13H18ClN3O/c14-13-2-1-10(9-16-13)12(18)5-8-17-6-3-11(15)4-7-17/h1-2,9,11H,3-8,15H2
SMILES:c1cc(Cl)ncc1C(=O)CCN1CCC(CC1)N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(4-Amino-piperidin-1-yl)-1-(6-chloro-pyridin-3-yl)-propan-1-one
CAS:Formula:C13H18ClN3OMolecular weight:267.7545
